C30H19F5O — CID 139857667
2-[2-[4-[2-(4-butoxy-2,6-difluorophenyl)ethynyl]-2,6-difluorophenyl]ethynyl]-6-fluoronaphthalene (PubChem CID 139857667) has the molecular formula C30H19F5O and a molecular weight of 490.47 g/mol. Its IUPAC name is 2-[2-[4-[2-(4-butoxy-2,6-difluorophenyl)ethynyl]-2,6-difluorophenyl]ethynyl]-6-fluoronaphthalene.
| Compound Name | 2-[2-[4-[2-(4-butoxy-2,6-difluorophenyl)ethynyl]-2,6-difluorophenyl]ethynyl]-6-fluoronaphthalene |
|---|---|
| PubChem CID | 139857667 |
| Molecular Formula | C30H19F5O |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 2-[2-[4-[2-(4-butoxy-2,6-difluorophenyl)ethynyl]-2,6-difluorophenyl]ethynyl]-6-fluoronaphthalene |
| SMILES | CCCCOc1cc(F)c(C#Cc2cc(F)c(C#Cc3ccc4cc(F)ccc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C30H19F5O/c1-2-3-12-36-24-17-29(34)26(30(35)18-24)11-6-20-14-27(32)25(28(33)15-20)10-5-19-4-7-22-16-23(31)9-8-21(22)13-19/h4,7-9,13-18H,2-3,12H2,1H3 |
| InChIKey | RPGHQLGQZZBSSL-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|