C31H21F5O — CID 139858605
6-[2-[4-[2-(2,6-difluoro-4-pentoxyphenyl)ethynyl]phenyl]ethynyl]-1,2,3-trifluoronaphthalene (PubChem CID 139858605) has the molecular formula C31H21F5O and a molecular weight of 504.50 g/mol. Its IUPAC name is 6-[2-[4-[2-(2,6-difluoro-4-pentoxyphenyl)ethynyl]phenyl]ethynyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[2-[4-[2-(2,6-difluoro-4-pentoxyphenyl)ethynyl]phenyl]ethynyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139858605 |
| Molecular Formula | C31H21F5O |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 6-[2-[4-[2-(2,6-difluoro-4-pentoxyphenyl)ethynyl]phenyl]ethynyl]-1,2,3-trifluoronaphthalene |
| SMILES | CCCCCOc1cc(F)c(C#Cc2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)cc2)c(F)c1 |
| InChI | InChI=1S/C31H21F5O/c1-2-3-4-15-37-24-18-27(32)26(28(33)19-24)14-11-21-7-5-20(6-8-21)9-10-22-12-13-25-23(16-22)17-29(34)31(36)30(25)35/h5-8,12-13,16-19H,2-4,15H2,1H3 |
| InChIKey | NVHQJMPHCZWWTM-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|