C27H13F5 — CID 139858728
6-[2-[4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]ethynyl]-1,2,3-trifluoronaphthalene (PubChem CID 139858728) has the molecular formula C27H13F5 and a molecular weight of 432.39 g/mol. Its IUPAC name is 6-[2-[4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]ethynyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[2-[4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]ethynyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139858728 |
| Molecular Formula | C27H13F5 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 6-[2-[4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]ethynyl]-1,2,3-trifluoronaphthalene |
| SMILES | Cc1cc(F)c(C#Cc2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)cc2)c(F)c1 |
| InChI | InChI=1S/C27H13F5/c1-16-12-23(28)22(24(29)13-16)11-8-18-4-2-17(3-5-18)6-7-19-9-10-21-20(14-19)15-25(30)27(32)26(21)31/h2-5,9-10,12-15H,1H3 |
| InChIKey | WPBRMWWAQZBQKR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|