C29H17F3O — CID 139857257
1,2,3-trifluoro-6-[2-[4-[2-(4-prop-2-enoxyphenyl)ethynyl]phenyl]ethynyl]naphthalene (PubChem CID 139857257) has the molecular formula C29H17F3O and a molecular weight of 438.45 g/mol. Its IUPAC name is 1,2,3-trifluoro-6-[2-[4-[2-(4-prop-2-enoxyphenyl)ethynyl]phenyl]ethynyl]naphthalene.
| Compound Name | 1,2,3-trifluoro-6-[2-[4-[2-(4-prop-2-enoxyphenyl)ethynyl]phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139857257 |
| Molecular Formula | C29H17F3O |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 1,2,3-trifluoro-6-[2-[4-[2-(4-prop-2-enoxyphenyl)ethynyl]phenyl]ethynyl]naphthalene |
| SMILES | C=CCOc1ccc(C#Cc2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)cc2)cc1 |
| InChI | InChI=1S/C29H17F3O/c1-2-17-33-25-14-11-22(12-15-25)8-7-20-3-5-21(6-4-20)9-10-23-13-16-26-24(18-23)19-27(30)29(32)28(26)31/h2-6,11-16,18-19H,1,17H2 |
| InChIKey | LVVDLFPBZDLZEL-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|