C20H11F7O2 — CID 139854100
6-[(2,6-difluoro-4-prop-2-enoxyphenyl)-difluoromethoxy]-1,2,3-trifluoronaphthalene (PubChem CID 139854100) has the molecular formula C20H11F7O2 and a molecular weight of 416.29 g/mol. Its IUPAC name is 6-[(2,6-difluoro-4-prop-2-enoxyphenyl)-difluoromethoxy]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[(2,6-difluoro-4-prop-2-enoxyphenyl)-difluoromethoxy]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139854100 |
| Molecular Formula | C20H11F7O2 |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 6-[(2,6-difluoro-4-prop-2-enoxyphenyl)-difluoromethoxy]-1,2,3-trifluoronaphthalene |
| SMILES | C=CCOc1cc(F)c(C(F)(F)Oc2ccc3c(F)c(F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C20H11F7O2/c1-2-5-28-12-8-14(21)17(15(22)9-12)20(26,27)29-11-3-4-13-10(6-11)7-16(23)19(25)18(13)24/h2-4,6-9H,1,5H2 |
| InChIKey | ZLEMLSXENGOQNQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|