C20H13F5O2 — CID 139854219
2-[(2,6-difluoro-4-prop-2-enoxyphenyl)-difluoromethoxy]-6-fluoronaphthalene (PubChem CID 139854219) has the molecular formula C20H13F5O2 and a molecular weight of 380.31 g/mol. Its IUPAC name is 2-[(2,6-difluoro-4-prop-2-enoxyphenyl)-difluoromethoxy]-6-fluoronaphthalene.
| Compound Name | 2-[(2,6-difluoro-4-prop-2-enoxyphenyl)-difluoromethoxy]-6-fluoronaphthalene |
|---|---|
| PubChem CID | 139854219 |
| Molecular Formula | C20H13F5O2 |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-[(2,6-difluoro-4-prop-2-enoxyphenyl)-difluoromethoxy]-6-fluoronaphthalene |
| SMILES | C=CCOc1cc(F)c(C(F)(F)Oc2ccc3cc(F)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C20H13F5O2/c1-2-7-26-16-10-17(22)19(18(23)11-16)20(24,25)27-15-6-4-12-8-14(21)5-3-13(12)9-15/h2-6,8-11H,1,7H2 |
| InChIKey | VUJRHRUNGHDHAU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|