C20H15F3O2 — CID 139854596
2,3-difluoro-6-[(2-fluoro-4-prop-2-enoxyphenyl)methoxy]naphthalene (PubChem CID 139854596) has the molecular formula C20H15F3O2 and a molecular weight of 344.33 g/mol. Its IUPAC name is 2,3-difluoro-6-[(2-fluoro-4-prop-2-enoxyphenyl)methoxy]naphthalene.
| Compound Name | 2,3-difluoro-6-[(2-fluoro-4-prop-2-enoxyphenyl)methoxy]naphthalene |
|---|---|
| PubChem CID | 139854596 |
| Molecular Formula | C20H15F3O2 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2,3-difluoro-6-[(2-fluoro-4-prop-2-enoxyphenyl)methoxy]naphthalene |
| SMILES | C=CCOc1ccc(COc2ccc3cc(F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C20H15F3O2/c1-2-7-24-17-6-4-14(18(21)11-17)12-25-16-5-3-13-9-19(22)20(23)10-15(13)8-16/h2-6,8-11H,1,7,12H2 |
| InChIKey | HBLNZECSQRHBMO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|