C20H14F4O2 — CID 139855297
2-(difluoromethoxy)-6-(2,6-difluoro-4-prop-2-enoxyphenyl)naphthalene (PubChem CID 139855297) has the molecular formula C20H14F4O2 and a molecular weight of 362.32 g/mol. Its IUPAC name is 2-(difluoromethoxy)-6-(2,6-difluoro-4-prop-2-enoxyphenyl)naphthalene.
| Compound Name | 2-(difluoromethoxy)-6-(2,6-difluoro-4-prop-2-enoxyphenyl)naphthalene |
|---|---|
| PubChem CID | 139855297 |
| Molecular Formula | C20H14F4O2 |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-(difluoromethoxy)-6-(2,6-difluoro-4-prop-2-enoxyphenyl)naphthalene |
| SMILES | C=CCOc1cc(F)c(-c2ccc3cc(OC(F)F)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C20H14F4O2/c1-2-7-25-16-10-17(21)19(18(22)11-16)14-4-3-13-9-15(26-20(23)24)6-5-12(13)8-14/h2-6,8-11,20H,1,7H2 |
| InChIKey | BTAJZAJNFXDHBH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|