C27H16F6O — CID 139856163
2-(2,2-difluoroethenyl)-6-[4-(2,6-difluoro-4-prop-2-enoxyphenyl)-2-fluorophenyl]-1-fluoronaphthalene (PubChem CID 139856163) has the molecular formula C27H16F6O and a molecular weight of 470.41 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-6-[4-(2,6-difluoro-4-prop-2-enoxyphenyl)-2-fluorophenyl]-1-fluoronaphthalene.
| Compound Name | 2-(2,2-difluoroethenyl)-6-[4-(2,6-difluoro-4-prop-2-enoxyphenyl)-2-fluorophenyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139856163 |
| Molecular Formula | C27H16F6O |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-6-[4-(2,6-difluoro-4-prop-2-enoxyphenyl)-2-fluorophenyl]-1-fluoronaphthalene |
| SMILES | C=CCOc1cc(F)c(-c2ccc(-c3ccc4c(F)c(C=C(F)F)ccc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C27H16F6O/c1-2-9-34-19-13-23(29)26(24(30)14-19)17-6-7-20(22(28)11-17)15-5-8-21-16(10-15)3-4-18(27(21)33)12-25(31)32/h2-8,10-14H,1,9H2 |
| InChIKey | CPLRSKPMAWIWJO-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|