C27H16F8O — CID 139856044
6-[4-(4-but-2-enoxy-2,6-difluorophenyl)-2-fluorophenyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene (PubChem CID 139856044) has the molecular formula C27H16F8O and a molecular weight of 508.41 g/mol. Its IUPAC name is 6-[4-(4-but-2-enoxy-2,6-difluorophenyl)-2-fluorophenyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene.
| Compound Name | 6-[4-(4-but-2-enoxy-2,6-difluorophenyl)-2-fluorophenyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 139856044 |
| Molecular Formula | C27H16F8O |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 6-[4-(4-but-2-enoxy-2,6-difluorophenyl)-2-fluorophenyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene |
| SMILES | CC=CCOc1cc(F)c(-c2ccc(-c3ccc4c(F)c(C(F)(F)F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C27H16F8O/c1-2-3-8-36-17-12-21(29)24(22(30)13-17)15-5-6-18(20(28)10-15)14-4-7-19-16(9-14)11-23(31)25(26(19)32)27(33,34)35/h2-7,9-13H,8H2,1H3 |
| InChIKey | PHKJNRURAUYQRT-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|