C31H19F7O2S — CID 134408848
6-[(E)-but-2-enoxy]-2-[difluoro-[3-fluoro-4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenoxy]methyl]-1-benzothiophene (PubChem CID 134408848) has the molecular formula C31H19F7O2S and a molecular weight of 588.54 g/mol. Its IUPAC name is 6-[(E)-but-2-enoxy]-2-[difluoro-[3-fluoro-4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenoxy]methyl]-1-benzothiophene.
| Compound Name | 6-[(E)-but-2-enoxy]-2-[difluoro-[3-fluoro-4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenoxy]methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 134408848 |
| Molecular Formula | C31H19F7O2S |
| Molecular Weight | 588.54 g/mol |
| Exact Mass | 588.10 |
| IUPAC Name | 6-[(E)-but-2-enoxy]-2-[difluoro-[3-fluoro-4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenoxy]methyl]-1-benzothiophene |
| SMILES | C/C=C/COc1ccc2cc(C(F)(F)Oc3ccc(-c4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)sc2c1 |
| InChI | InChI=1S/C31H19F7O2S/c1-2-3-10-39-20-6-4-18-14-29(41-28(18)16-20)31(37,38)40-21-7-9-22(25(33)15-21)17-5-8-23(24(32)11-17)19-12-26(34)30(36)27(35)13-19/h2-9,11-16H,10H2,1H3/b3-2+ |
| InChIKey | BWCVMPSBHVJRBD-NSCUHMNNSA-N |
| XLogP | 10.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.54 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|