C26H15F9O — CID 118900691
3-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,2,8-trifluoro-7-propylnaphthalene (PubChem CID 118900691) has the molecular formula C26H15F9O and a molecular weight of 514.39 g/mol. Its IUPAC name is 3-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,2,8-trifluoro-7-propylnaphthalene.
| Compound Name | 3-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,2,8-trifluoro-7-propylnaphthalene |
|---|---|
| PubChem CID | 118900691 |
| Molecular Formula | C26H15F9O |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 3-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,2,8-trifluoro-7-propylnaphthalene |
| SMILES | CCCc1ccc2cc(C(F)(F)Oc3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)c(F)c(F)c2c1F |
| InChI | InChI=1S/C26H15F9O/c1-2-3-12-4-5-13-8-17(23(31)25(33)21(13)22(12)30)26(34,35)36-15-6-7-16(18(27)11-15)14-9-19(28)24(32)20(29)10-14/h4-11H,2-3H2,1H3 |
| InChIKey | GLEPCBCZFJKVGW-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|