C20H13F7N2O — CID 118601468
5-(2,3-difluoro-4-propylphenyl)-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]pyrimidine (PubChem CID 118601468) has the molecular formula C20H13F7N2O and a molecular weight of 430.32 g/mol. Its IUPAC name is 5-(2,3-difluoro-4-propylphenyl)-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]pyrimidine.
| Compound Name | 5-(2,3-difluoro-4-propylphenyl)-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]pyrimidine |
|---|---|
| PubChem CID | 118601468 |
| Molecular Formula | C20H13F7N2O |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 5-(2,3-difluoro-4-propylphenyl)-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]pyrimidine |
| SMILES | CCCc1ccc(-c2cnc(C(F)(F)Oc3cc(F)c(F)c(F)c3)nc2)c(F)c1F |
| InChI | InChI=1S/C20H13F7N2O/c1-2-3-10-4-5-13(17(24)16(10)23)11-8-28-19(29-9-11)20(26,27)30-12-6-14(21)18(25)15(22)7-12/h4-9H,2-3H2,1H3 |
| InChIKey | NNBLAUGCMFSHBZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|