C24H14F8N2O — CID 118900637
2-[difluoro-[3,4,5-trifluoro-6-(3,4,5-trifluorophenyl)naphthalen-2-yl]oxymethyl]-5-propylpyrimidine (PubChem CID 118900637) has the molecular formula C24H14F8N2O and a molecular weight of 498.37 g/mol. Its IUPAC name is 2-[difluoro-[3,4,5-trifluoro-6-(3,4,5-trifluorophenyl)naphthalen-2-yl]oxymethyl]-5-propylpyrimidine.
| Compound Name | 2-[difluoro-[3,4,5-trifluoro-6-(3,4,5-trifluorophenyl)naphthalen-2-yl]oxymethyl]-5-propylpyrimidine |
|---|---|
| PubChem CID | 118900637 |
| Molecular Formula | C24H14F8N2O |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 2-[difluoro-[3,4,5-trifluoro-6-(3,4,5-trifluorophenyl)naphthalen-2-yl]oxymethyl]-5-propylpyrimidine |
| SMILES | CCCc1cnc(C(F)(F)Oc2cc3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3c(F)c2F)nc1 |
| InChI | InChI=1S/C24H14F8N2O/c1-2-3-11-9-33-23(34-10-11)24(31,32)35-17-8-12-4-5-14(19(27)18(12)22(30)21(17)29)13-6-15(25)20(28)16(26)7-13/h4-10H,2-3H2,1H3 |
| InChIKey | DFRJRFDDZRDCIK-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|