C38H24F8O — CID 118894722
3-[difluoro-[4-(4-propylphenyl)phenyl]methoxy]-1,2,8-trifluoro-7-[4-(3,4,5-trifluorophenyl)phenyl]naphthalene (PubChem CID 118894722) has the molecular formula C38H24F8O and a molecular weight of 648.59 g/mol. Its IUPAC name is 3-[difluoro-[4-(4-propylphenyl)phenyl]methoxy]-1,2,8-trifluoro-7-[4-(3,4,5-trifluorophenyl)phenyl]naphthalene.
| Compound Name | 3-[difluoro-[4-(4-propylphenyl)phenyl]methoxy]-1,2,8-trifluoro-7-[4-(3,4,5-trifluorophenyl)phenyl]naphthalene |
|---|---|
| PubChem CID | 118894722 |
| Molecular Formula | C38H24F8O |
| Molecular Weight | 648.59 g/mol |
| Exact Mass | 648.17 |
| IUPAC Name | 3-[difluoro-[4-(4-propylphenyl)phenyl]methoxy]-1,2,8-trifluoro-7-[4-(3,4,5-trifluorophenyl)phenyl]naphthalene |
| SMILES | CCCc1ccc(-c2ccc(C(F)(F)Oc3cc4ccc(-c5ccc(-c6cc(F)c(F)c(F)c6)cc5)c(F)c4c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C38H24F8O/c1-2-3-21-4-6-22(7-5-21)23-12-15-28(16-13-23)38(45,46)47-32-20-26-14-17-29(34(41)33(26)37(44)36(32)43)25-10-8-24(9-11-25)27-18-30(39)35(42)31(40)19-27/h4-20H,2-3H2,1H3 |
| InChIKey | UXWRVWUYVFFNDQ-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.59 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|