C23H15F7O — CID 118601260
1-[(4-but-3-enylphenyl)-difluoromethoxy]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene (PubChem CID 118601260) has the molecular formula C23H15F7O and a molecular weight of 440.36 g/mol. Its IUPAC name is 1-[(4-but-3-enylphenyl)-difluoromethoxy]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene.
| Compound Name | 1-[(4-but-3-enylphenyl)-difluoromethoxy]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 118601260 |
| Molecular Formula | C23H15F7O |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 1-[(4-but-3-enylphenyl)-difluoromethoxy]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene |
| SMILES | C=CCCc1ccc(C(F)(F)Oc2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2F)cc1 |
| InChI | InChI=1S/C23H15F7O/c1-2-3-4-13-5-7-15(8-6-13)23(29,30)31-19-10-9-16(20(26)22(19)28)14-11-17(24)21(27)18(25)12-14/h2,5-12H,1,3-4H2 |
| InChIKey | PQZRSRYEQSPYKP-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|