C24H17F7O2 — CID 118858629
1-(4-but-3-enylphenyl)-4-[2,2-difluoro-2-(3,4,5-trifluorophenoxy)ethoxy]-2,3-difluorobenzene (PubChem CID 118858629) has the molecular formula C24H17F7O2 and a molecular weight of 470.38 g/mol. Its IUPAC name is 1-(4-but-3-enylphenyl)-4-[2,2-difluoro-2-(3,4,5-trifluorophenoxy)ethoxy]-2,3-difluorobenzene.
| Compound Name | 1-(4-but-3-enylphenyl)-4-[2,2-difluoro-2-(3,4,5-trifluorophenoxy)ethoxy]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 118858629 |
| Molecular Formula | C24H17F7O2 |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 1-(4-but-3-enylphenyl)-4-[2,2-difluoro-2-(3,4,5-trifluorophenoxy)ethoxy]-2,3-difluorobenzene |
| SMILES | C=CCCc1ccc(-c2ccc(OCC(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2F)cc1 |
| InChI | InChI=1S/C24H17F7O2/c1-2-3-4-14-5-7-15(8-6-14)17-9-10-20(23(29)21(17)27)32-13-24(30,31)33-16-11-18(25)22(28)19(26)12-16/h2,5-12H,1,3-4,13H2 |
| InChIKey | TVFULRXSKWFEHQ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|