C34H20F9NO — CID 58383679
5-but-3-enyl-2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-3-fluorophenyl]pyridine (PubChem CID 58383679) has the molecular formula C34H20F9NO and a molecular weight of 629.52 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-3-fluorophenyl]pyridine.
| Compound Name | 5-but-3-enyl-2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-3-fluorophenyl]pyridine |
|---|---|
| PubChem CID | 58383679 |
| Molecular Formula | C34H20F9NO |
| Molecular Weight | 629.52 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | 5-but-3-enyl-2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-3-fluorophenyl]pyridine |
| SMILES | C=CCCc1ccc(-c2ccc(-c3cc(F)c(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C34H20F9NO/c1-2-3-4-18-5-10-31(44-17-18)19-6-8-23(25(35)11-19)20-12-27(37)32(28(38)13-20)34(42,43)45-22-7-9-24(26(36)16-22)21-14-29(39)33(41)30(40)15-21/h2,5-17H,1,3-4H2 |
| InChIKey | CYTRRFVDGMCTGF-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.52 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|