C30H18F7NOS — CID 146335315
6-(4-but-3-enylphenyl)-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,3-benzothiazole (PubChem CID 146335315) has the molecular formula C30H18F7NOS and a molecular weight of 573.53 g/mol. Its IUPAC name is 6-(4-but-3-enylphenyl)-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,3-benzothiazole.
| Compound Name | 6-(4-but-3-enylphenyl)-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335315 |
| Molecular Formula | C30H18F7NOS |
| Molecular Weight | 573.53 g/mol |
| Exact Mass | 573.10 |
| IUPAC Name | 6-(4-but-3-enylphenyl)-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,3-benzothiazole |
| SMILES | C=CCCc1ccc(-c2ccc3nc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)sc3c2)cc1 |
| InChI | InChI=1S/C30H18F7NOS/c1-2-3-4-16-5-7-17(8-6-16)18-9-10-25-26(13-18)40-29(38-25)19-11-21(31)27(22(32)12-19)30(36,37)39-20-14-23(33)28(35)24(34)15-20/h2,5-15H,1,3-4H2 |
| InChIKey | FFWSLTJDADRDCO-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.53 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|