C24H16F5NOS2 — CID 146335481
6-(4-but-3-enylsulfanylphenyl)-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazole (PubChem CID 146335481) has the molecular formula C24H16F5NOS2 and a molecular weight of 493.52 g/mol. Its IUPAC name is 6-(4-but-3-enylsulfanylphenyl)-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazole.
| Compound Name | 6-(4-but-3-enylsulfanylphenyl)-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335481 |
| Molecular Formula | C24H16F5NOS2 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 6-(4-but-3-enylsulfanylphenyl)-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazole |
| SMILES | C=CCCSc1ccc(-c2ccc3nc(C(F)(F)Oc4cc(F)c(F)c(F)c4)sc3c2)cc1 |
| InChI | InChI=1S/C24H16F5NOS2/c1-2-3-10-32-17-7-4-14(5-8-17)15-6-9-20-21(11-15)33-23(30-20)24(28,29)31-16-12-18(25)22(27)19(26)13-16/h2,4-9,11-13H,1,3,10H2 |
| InChIKey | FMLPJDZDNJLFPD-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|