C22H18F5NOS — CID 146335258
6-[(E)-2-cyclohexylethenyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazole (PubChem CID 146335258) has the molecular formula C22H18F5NOS and a molecular weight of 439.45 g/mol. Its IUPAC name is 6-[(E)-2-cyclohexylethenyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazole.
| Compound Name | 6-[(E)-2-cyclohexylethenyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335258 |
| Molecular Formula | C22H18F5NOS |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 6-[(E)-2-cyclohexylethenyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazole |
| SMILES | Fc1cc(OC(F)(F)c2nc3ccc(/C=C/C4CCCCC4)cc3s2)cc(F)c1F |
| InChI | InChI=1S/C22H18F5NOS/c23-16-11-15(12-17(24)20(16)25)29-22(26,27)21-28-18-9-8-14(10-19(18)30-21)7-6-13-4-2-1-3-5-13/h6-13H,1-5H2/b7-6+ |
| InChIKey | IPJMQYHOYPIPEJ-VOTSOKGWSA-N |
| XLogP | 7.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|