C18H12F5NOS2 — CID 146335040
6-but-3-enylsulfanyl-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazole (PubChem CID 146335040) has the molecular formula C18H12F5NOS2 and a molecular weight of 417.42 g/mol. Its IUPAC name is 6-but-3-enylsulfanyl-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazole.
| Compound Name | 6-but-3-enylsulfanyl-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335040 |
| Molecular Formula | C18H12F5NOS2 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 6-but-3-enylsulfanyl-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-benzothiazole |
| SMILES | C=CCCSc1ccc2nc(C(F)(F)Oc3cc(F)c(F)c(F)c3)sc2c1 |
| InChI | InChI=1S/C18H12F5NOS2/c1-2-3-6-26-11-4-5-14-15(9-11)27-17(24-14)18(22,23)25-10-7-12(19)16(21)13(20)8-10/h2,4-5,7-9H,1,3,6H2 |
| InChIKey | GIEVDWHRAPXQBM-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|