C25H26F5NOS — CID 146335254
2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-6-[2-(4-propylcyclohexyl)ethyl]-1,3-benzothiazole (PubChem CID 146335254) has the molecular formula C25H26F5NOS and a molecular weight of 483.55 g/mol. Its IUPAC name is 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-6-[2-(4-propylcyclohexyl)ethyl]-1,3-benzothiazole.
| Compound Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-6-[2-(4-propylcyclohexyl)ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335254 |
| Molecular Formula | C25H26F5NOS |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-6-[2-(4-propylcyclohexyl)ethyl]-1,3-benzothiazole |
| SMILES | CCCC1CCC(CCc2ccc3nc(C(F)(F)Oc4cc(F)c(F)c(F)c4)sc3c2)CC1 |
| InChI | InChI=1S/C25H26F5NOS/c1-2-3-15-4-6-16(7-5-15)8-9-17-10-11-21-22(12-17)33-24(31-21)25(29,30)32-18-13-19(26)23(28)20(27)14-18/h10-16H,2-9H2,1H3 |
| InChIKey | NIPMDMDPNRLCIV-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|