C24H15F6NOS — CID 146335240
6-but-3-enyl-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]-1,3-benzothiazole (PubChem CID 146335240) has the molecular formula C24H15F6NOS and a molecular weight of 479.45 g/mol. Its IUPAC name is 6-but-3-enyl-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]-1,3-benzothiazole.
| Compound Name | 6-but-3-enyl-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335240 |
| Molecular Formula | C24H15F6NOS |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 6-but-3-enyl-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]-1,3-benzothiazole |
| SMILES | C=CCCc1ccc2nc(-c3ccc(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)sc2c1 |
| InChI | InChI=1S/C24H15F6NOS/c1-2-3-4-13-5-8-20-21(9-13)33-23(31-20)14-6-7-16(17(25)10-14)24(29,30)32-15-11-18(26)22(28)19(27)12-15/h2,5-12H,1,3-4H2 |
| InChIKey | KCJZXWDRPHQPOG-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|