C34H23F8NOS — CID 146335543
2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-6-(4-ethenylcyclohexyl)-1,3-benzothiazole (PubChem CID 146335543) has the molecular formula C34H23F8NOS and a molecular weight of 645.62 g/mol. Its IUPAC name is 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-6-(4-ethenylcyclohexyl)-1,3-benzothiazole.
| Compound Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-6-(4-ethenylcyclohexyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335543 |
| Molecular Formula | C34H23F8NOS |
| Molecular Weight | 645.62 g/mol |
| Exact Mass | 645.14 |
| IUPAC Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-6-(4-ethenylcyclohexyl)-1,3-benzothiazole |
| SMILES | C=CC1CCC(c2ccc3nc(-c4ccc(-c5cc(F)c(C(F)(F)Oc6cc(F)c(F)c(F)c6)c(F)c5)c(F)c4)sc3c2)CC1 |
| InChI | InChI=1S/C34H23F8NOS/c1-2-17-3-5-18(6-4-17)19-8-10-29-30(14-19)45-33(43-29)20-7-9-23(24(35)11-20)21-12-25(36)31(26(37)13-21)34(41,42)44-22-15-27(38)32(40)28(39)16-22/h2,7-18H,1,3-6H2 |
| InChIKey | LRWFWHUBJYAUMU-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.62 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|