C33H25F7O — CID 59329231
5-[[4-[4-[4-(4-ethenylcyclohexyl)phenyl]-2-fluorophenyl]-2-fluorophenyl]-difluoromethoxy]-1,2,3-trifluorobenzene (PubChem CID 59329231) has the molecular formula C33H25F7O and a molecular weight of 570.55 g/mol. Its IUPAC name is 5-[[4-[4-[4-(4-ethenylcyclohexyl)phenyl]-2-fluorophenyl]-2-fluorophenyl]-difluoromethoxy]-1,2,3-trifluorobenzene.
| Compound Name | 5-[[4-[4-[4-(4-ethenylcyclohexyl)phenyl]-2-fluorophenyl]-2-fluorophenyl]-difluoromethoxy]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 59329231 |
| Molecular Formula | C33H25F7O |
| Molecular Weight | 570.55 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | 5-[[4-[4-[4-(4-ethenylcyclohexyl)phenyl]-2-fluorophenyl]-2-fluorophenyl]-difluoromethoxy]-1,2,3-trifluorobenzene |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(-c4ccc(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C33H25F7O/c1-2-19-3-5-20(6-4-19)21-7-9-22(10-8-21)23-11-13-26(28(34)15-23)24-12-14-27(29(35)16-24)33(39,40)41-25-17-30(36)32(38)31(37)18-25/h2,7-20H,1,3-6H2 |
| InChIKey | LIWOFQYYXSVVCI-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.55 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|