C35H27F9O — CID 59328154
5-[4-[4-[4-[(E)-but-1-enyl]cyclohexyl]-2-fluorophenyl]-2-fluorophenyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene (PubChem CID 59328154) has the molecular formula C35H27F9O and a molecular weight of 634.58 g/mol. Its IUPAC name is 5-[4-[4-[4-[(E)-but-1-enyl]cyclohexyl]-2-fluorophenyl]-2-fluorophenyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene.
| Compound Name | 5-[4-[4-[4-[(E)-but-1-enyl]cyclohexyl]-2-fluorophenyl]-2-fluorophenyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 59328154 |
| Molecular Formula | C35H27F9O |
| Molecular Weight | 634.58 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | 5-[4-[4-[4-[(E)-but-1-enyl]cyclohexyl]-2-fluorophenyl]-2-fluorophenyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene |
| SMILES | CC/C=C/C1CCC(c2ccc(-c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C35H27F9O/c1-2-3-4-19-5-7-20(8-6-19)21-9-11-25(27(36)13-21)22-10-12-26(28(37)14-22)23-15-29(38)33(30(39)16-23)35(43,44)45-24-17-31(40)34(42)32(41)18-24/h3-4,9-20H,2,5-8H2,1H3/b4-3+ |
| InChIKey | CQJBJXCVAPGAKS-ONEGZZNKSA-N |
| XLogP | 11.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.58 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|