C35H34F8O2 — CID 59328200
5-[4-[4-[4-[(E)-but-2-enoxy]cyclohexyl]cyclohexyl]-2-fluorophenyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene (PubChem CID 59328200) has the molecular formula C35H34F8O2 and a molecular weight of 638.64 g/mol. Its IUPAC name is 5-[4-[4-[4-[(E)-but-2-enoxy]cyclohexyl]cyclohexyl]-2-fluorophenyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene.
| Compound Name | 5-[4-[4-[4-[(E)-but-2-enoxy]cyclohexyl]cyclohexyl]-2-fluorophenyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 59328200 |
| Molecular Formula | C35H34F8O2 |
| Molecular Weight | 638.64 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | 5-[4-[4-[4-[(E)-but-2-enoxy]cyclohexyl]cyclohexyl]-2-fluorophenyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene |
| SMILES | C/C=C/COC1CCC(C2CCC(c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C35H34F8O2/c1-2-3-14-44-25-11-8-21(9-12-25)20-4-6-22(7-5-20)23-10-13-27(28(36)15-23)24-16-29(37)33(30(38)17-24)35(42,43)45-26-18-31(39)34(41)32(40)19-26/h2-3,10,13,15-22,25H,4-9,11-12,14H2,1H3/b3-2+ |
| InChIKey | OTQMGRYWAIIZHD-NSCUHMNNSA-N |
| XLogP | 10.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.64 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|