C35H36F8O2 — CID 59327907
2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-[4-[4-[4-(2-ethoxyethyl)cyclohexyl]cyclohexyl]-2-fluorophenyl]-1,3-difluorobenzene (PubChem CID 59327907) has the molecular formula C35H36F8O2 and a molecular weight of 640.66 g/mol. Its IUPAC name is 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-[4-[4-[4-(2-ethoxyethyl)cyclohexyl]cyclohexyl]-2-fluorophenyl]-1,3-difluorobenzene.
| Compound Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-[4-[4-[4-(2-ethoxyethyl)cyclohexyl]cyclohexyl]-2-fluorophenyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 59327907 |
| Molecular Formula | C35H36F8O2 |
| Molecular Weight | 640.66 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-[4-[4-[4-(2-ethoxyethyl)cyclohexyl]cyclohexyl]-2-fluorophenyl]-1,3-difluorobenzene |
| SMILES | CCOCCC1CCC(C2CCC(c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C35H36F8O2/c1-2-44-14-13-20-3-5-21(6-4-20)22-7-9-23(10-8-22)24-11-12-27(28(36)15-24)25-16-29(37)33(30(38)17-25)35(42,43)45-26-18-31(39)34(41)32(40)19-26/h11-12,15-23H,2-10,13-14H2,1H3 |
| InChIKey | ABYPTULWIGJZRJ-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.66 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|