C29H27F7O2 — CID 134222816
1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-4-[4-[4-(2-ethoxyethyl)cyclohexyl]phenyl]-2,3-difluorobenzene (PubChem CID 134222816) has the molecular formula C29H27F7O2 and a molecular weight of 540.52 g/mol. Its IUPAC name is 1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-4-[4-[4-(2-ethoxyethyl)cyclohexyl]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-4-[4-[4-(2-ethoxyethyl)cyclohexyl]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 134222816 |
| Molecular Formula | C29H27F7O2 |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-4-[4-[4-(2-ethoxyethyl)cyclohexyl]phenyl]-2,3-difluorobenzene |
| SMILES | CCOCCC1CCC(c2ccc(-c3ccc(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C29H27F7O2/c1-2-37-14-13-17-3-5-18(6-4-17)19-7-9-20(10-8-19)22-11-12-23(27(33)26(22)32)29(35,36)38-21-15-24(30)28(34)25(31)16-21/h7-12,15-18H,2-6,13-14H2,1H3 |
| InChIKey | LTVQPFPTOZDHTR-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|