C23H23F7O2 — CID 134222769
1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-4-[4-(2-ethoxyethyl)cyclohexyl]-2,3-difluorobenzene (PubChem CID 134222769) has the molecular formula C23H23F7O2 and a molecular weight of 464.42 g/mol. Its IUPAC name is 1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-4-[4-(2-ethoxyethyl)cyclohexyl]-2,3-difluorobenzene.
| Compound Name | 1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-4-[4-(2-ethoxyethyl)cyclohexyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 134222769 |
| Molecular Formula | C23H23F7O2 |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-4-[4-(2-ethoxyethyl)cyclohexyl]-2,3-difluorobenzene |
| SMILES | CCOCCC1CCC(c2ccc(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2F)CC1 |
| InChI | InChI=1S/C23H23F7O2/c1-2-31-10-9-13-3-5-14(6-4-13)16-7-8-17(21(27)20(16)26)23(29,30)32-15-11-18(24)22(28)19(25)12-15/h7-8,11-14H,2-6,9-10H2,1H3 |
| InChIKey | OAPSUMDOOFGWKO-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|