C19H15F7O2 — CID 129159350
5-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenyl]-2-methyloxane (PubChem CID 129159350) has the molecular formula C19H15F7O2 and a molecular weight of 408.31 g/mol. Its IUPAC name is 5-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenyl]-2-methyloxane.
| Compound Name | 5-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenyl]-2-methyloxane |
|---|---|
| PubChem CID | 129159350 |
| Molecular Formula | C19H15F7O2 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 5-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenyl]-2-methyloxane |
| SMILES | CC1CCC(c2ccc(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2F)CO1 |
| InChI | InChI=1S/C19H15F7O2/c1-9-2-3-10(8-27-9)12-4-5-13(17(23)16(12)22)19(25,26)28-11-6-14(20)18(24)15(21)7-11/h4-7,9-10H,2-3,8H2,1H3 |
| InChIKey | QSXFSUVLRBNILX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|