C12H13F2IO — CID 134454496
5-(2,3-difluoro-4-iodophenyl)-2-methyloxane (PubChem CID 134454496) has the molecular formula C12H13F2IO and a molecular weight of 338.14 g/mol. Its IUPAC name is 5-(2,3-difluoro-4-iodophenyl)-2-methyloxane.
| Compound Name | 5-(2,3-difluoro-4-iodophenyl)-2-methyloxane |
|---|---|
| PubChem CID | 134454496 |
| Molecular Formula | C12H13F2IO |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 5-(2,3-difluoro-4-iodophenyl)-2-methyloxane |
| SMILES | CC1CCC(c2ccc(I)c(F)c2F)CO1 |
| InChI | InChI=1S/C12H13F2IO/c1-7-2-3-8(6-16-7)9-4-5-10(15)12(14)11(9)13/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | LGCMKIMRHWSAKV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|