C19H20F2O — CID 21337873
5-(2,3-difluoro-4-methylphenyl)-2-(4-methylphenyl)oxane (PubChem CID 21337873) has the molecular formula C19H20F2O and a molecular weight of 302.36 g/mol. Its IUPAC name is 5-(2,3-difluoro-4-methylphenyl)-2-(4-methylphenyl)oxane.
| Compound Name | 5-(2,3-difluoro-4-methylphenyl)-2-(4-methylphenyl)oxane |
|---|---|
| PubChem CID | 21337873 |
| Molecular Formula | C19H20F2O |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5-(2,3-difluoro-4-methylphenyl)-2-(4-methylphenyl)oxane |
| SMILES | Cc1ccc(C2CCC(c3ccc(C)c(F)c3F)CO2)cc1 |
| InChI | InChI=1S/C19H20F2O/c1-12-3-6-14(7-4-12)17-10-8-15(11-22-17)16-9-5-13(2)18(20)19(16)21/h3-7,9,15,17H,8,10-11H2,1-2H3 |
| InChIKey | CHVNVBAHXNXTRZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |