About (2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane
(2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane (PubChem CID 118188483) has the molecular formula C13H16F2O
and a molecular weight of 226.27 g/mol. Its IUPAC name is (2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane.
Molecular Properties
| Compound Name | (2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane |
| PubChem CID | 118188483 |
| Molecular Formula | C13H16F2O |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane |
| SMILES | Cc1ccc([C@@H]2CCC(C)CO2)c(F)c1F |
| InChI | InChI=1S/C13H16F2O/c1-8-3-6-11(16-7-8)10-5-4-9(2)12(14)13(10)15/h4-5,8,11H,3,6-7H2,1-2H3/t8?,11-/m0/s1 |
| InChIKey | MUKJGWIOUVFVHZ-LYNSQETBSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane?
The IUPAC name of (2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane (CID 118188483) is (2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane.
What is the SMILES notation for (2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane?
The canonical SMILES for (2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane is Cc1ccc([C@@H]2CCC(C)CO2)c(F)c1F.
What is the InChIKey of (2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane?
The InChIKey is MUKJGWIOUVFVHZ-LYNSQETBSA-N. The full InChI is InChI=1S/C13H16F2O/c1-8-3-6-11(16-7-8)10-5-4-9(2)12(14)13(10)15/h4-5,8,11H,3,6-7H2,1-2H3/t8?,11-/m0/s1.
What are the key properties of (2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane?
(2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane has a molecular weight of 226.27 g/mol, XLogP of 3.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,3-difluoro-4-methylphenyl)-5-methyloxane is sourced from PubChem (CID 118188483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).