C27H25F3O3 — CID 89045959
2-[[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]-2-fluorophenoxy]methyl]-5-methyloxane (PubChem CID 89045959) has the molecular formula C27H25F3O3 and a molecular weight of 454.49 g/mol. Its IUPAC name is 2-[[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]-2-fluorophenoxy]methyl]-5-methyloxane.
| Compound Name | 2-[[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]-2-fluorophenoxy]methyl]-5-methyloxane |
|---|---|
| PubChem CID | 89045959 |
| Molecular Formula | C27H25F3O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 2-[[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]-2-fluorophenoxy]methyl]-5-methyloxane |
| SMILES | CC1CCC(COc2ccc(-c3ccc(-c4ccc(C5CO5)c(F)c4F)cc3)cc2F)OC1 |
| InChI | InChI=1S/C27H25F3O3/c1-16-2-8-20(31-13-16)14-32-24-11-7-19(12-23(24)28)17-3-5-18(6-4-17)21-9-10-22(25-15-33-25)27(30)26(21)29/h3-7,9-12,16,20,25H,2,8,13-15H2,1H3 |
| InChIKey | MUQLKYHXECYOHD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|