C25H22BF3O2 — CID 88998272
CID 88998272 (PubChem CID 88998272) has the molecular formula C25H22BF3O2 and a molecular weight of 422.26 g/mol.
| Compound Name | CID 88998272 |
|---|---|
| PubChem CID | 88998272 |
| Molecular Formula | C25H22BF3O2 |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | — |
| SMILES | [B]COc1ccc(-c2ccc(-c3ccc(C4CCC(C)CO4)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C25H22BF3O2/c1-15-2-10-22(30-13-15)18-7-8-19(21(27)12-18)16-3-5-17(6-4-16)20-9-11-23(31-14-26)25(29)24(20)28/h3-9,11-12,15,22H,2,10,13-14H2,1H3 |
| InChIKey | LNYZDGWQJAKDSO-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|