C28H25F3O2 — CID 70820798
2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-3-fluorophenyl]ethynyl]-5-methyloxane (PubChem CID 70820798) has the molecular formula C28H25F3O2 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-3-fluorophenyl]ethynyl]-5-methyloxane.
| Compound Name | 2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-3-fluorophenyl]ethynyl]-5-methyloxane |
|---|---|
| PubChem CID | 70820798 |
| Molecular Formula | C28H25F3O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-3-fluorophenyl]ethynyl]-5-methyloxane |
| SMILES | CCOc1ccc(-c2ccc(-c3ccc(C#CC4CCC(C)CO4)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C28H25F3O2/c1-3-32-26-15-14-24(27(30)28(26)31)21-9-7-20(8-10-21)23-13-6-19(16-25(23)29)5-12-22-11-4-18(2)17-33-22/h6-10,13-16,18,22H,3-4,11,17H2,1-2H3 |
| InChIKey | YFZNOAPBBGHWNF-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|