C34H37F3O2 — CID 67740517
2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]ethynyl]-5-heptyloxane (PubChem CID 67740517) has the molecular formula C34H37F3O2 and a molecular weight of 534.66 g/mol. Its IUPAC name is 2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]ethynyl]-5-heptyloxane.
| Compound Name | 2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]ethynyl]-5-heptyloxane |
|---|---|
| PubChem CID | 67740517 |
| Molecular Formula | C34H37F3O2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]ethynyl]-5-heptyloxane |
| SMILES | CCCCCCCC1CCC(C#Cc2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)cc3)cc2F)OC1 |
| InChI | InChI=1S/C34H37F3O2/c1-3-5-6-7-8-9-24-10-18-29(39-23-24)19-17-27-15-16-28(22-31(27)35)25-11-13-26(14-12-25)30-20-21-32(38-4-2)34(37)33(30)36/h11-16,20-22,24,29H,3-10,18,23H2,1-2H3 |
| InChIKey | LVAXULMMHCHKBP-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|