C18H16F4O — CID 58937386
2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methyloxane (PubChem CID 58937386) has the molecular formula C18H16F4O and a molecular weight of 324.32 g/mol. Its IUPAC name is 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methyloxane.
| Compound Name | 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methyloxane |
|---|---|
| PubChem CID | 58937386 |
| Molecular Formula | C18H16F4O |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methyloxane |
| SMILES | CC1CCC(c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C18H16F4O/c1-10-2-5-17(23-9-10)11-3-4-13(14(19)6-11)12-7-15(20)18(22)16(21)8-12/h3-4,6-8,10,17H,2,5,9H2,1H3 |
| InChIKey | BXODCSVZXOTOEN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|