C25H19F7O — CID 145223015
2-[4-[4-[difluoro-(3,4,5-trifluorophenyl)methyl]-3,5-difluorophenyl]phenyl]-5-methyloxane (PubChem CID 145223015) has the molecular formula C25H19F7O and a molecular weight of 468.41 g/mol. Its IUPAC name is 2-[4-[4-[difluoro-(3,4,5-trifluorophenyl)methyl]-3,5-difluorophenyl]phenyl]-5-methyloxane.
| Compound Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenyl)methyl]-3,5-difluorophenyl]phenyl]-5-methyloxane |
|---|---|
| PubChem CID | 145223015 |
| Molecular Formula | C25H19F7O |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenyl)methyl]-3,5-difluorophenyl]phenyl]-5-methyloxane |
| SMILES | CC1CCC(c2ccc(-c3cc(F)c(C(F)(F)c4cc(F)c(F)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C25H19F7O/c1-13-2-7-22(33-12-13)15-5-3-14(4-6-15)16-8-18(26)23(19(27)9-16)25(31,32)17-10-20(28)24(30)21(29)11-17/h3-6,8-11,13,22H,2,7,12H2,1H3 |
| InChIKey | UIAHSJXMDOFIOP-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|