C34H30F6O4 — CID 145172621
5-methyl-2-[4-(3,4,5-trifluorophenyl)phenyl]-1,3-dioxane (PubChem CID 145172621) has the molecular formula C34H30F6O4 and a molecular weight of 616.60 g/mol. Its IUPAC name is 5-methyl-2-[4-(3,4,5-trifluorophenyl)phenyl]-1,3-dioxane.
| Compound Name | 5-methyl-2-[4-(3,4,5-trifluorophenyl)phenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 145172621 |
| Molecular Formula | C34H30F6O4 |
| Molecular Weight | 616.60 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | 5-methyl-2-[4-(3,4,5-trifluorophenyl)phenyl]-1,3-dioxane |
| SMILES | CC1COC(c2ccc(-c3cc(F)c(F)c(F)c3)cc2)OC1.CC1COC(c2ccc(-c3cc(F)c(F)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/2C17H15F3O2/c2*1-10-8-21-17(22-9-10)12-4-2-11(3-5-12)13-6-14(18)16(20)15(19)7-13/h2*2-7,10,17H,8-9H2,1H3 |
| InChIKey | QNRUHEXRZJJXPL-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.60 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|