C48H32F16O6 — CID 144764097
2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-methyl-1,3-dioxane (PubChem CID 144764097) has the molecular formula C48H32F16O6 and a molecular weight of 1008.75 g/mol. Its IUPAC name is 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-methyl-1,3-dioxane.
| Compound Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 144764097 |
| Molecular Formula | C48H32F16O6 |
| Molecular Weight | 1008.75 g/mol |
| Exact Mass | 1008.19 |
| IUPAC Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-methyl-1,3-dioxane |
| SMILES | CC1COC(c2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)OC1.CC1COC(c2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/2C24H16F8O3/c2*1-11-9-33-23(34-10-11)12-2-3-15(16(25)4-12)13-5-17(26)21(18(27)6-13)24(31,32)35-14-7-19(28)22(30)20(29)8-14/h2*2-8,11,23H,9-10H2,1H3 |
| InChIKey | ZTYQADQRVNLYRW-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1008.75 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|