C31H17F11O3 — CID 138468147
2-[4-[4-[difluoro-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-methyl-1,3-dioxane (PubChem CID 138468147) has the molecular formula C31H17F11O3 and a molecular weight of 646.45 g/mol. Its IUPAC name is 2-[4-[4-[difluoro-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-methyl-1,3-dioxane.
| Compound Name | 2-[4-[4-[difluoro-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 138468147 |
| Molecular Formula | C31H17F11O3 |
| Molecular Weight | 646.45 g/mol |
| Exact Mass | 646.10 |
| IUPAC Name | 2-[4-[4-[difluoro-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-methyl-1,3-dioxane |
| SMILES | CC1COC(c2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c5c(F)c(C#CC(F)(F)F)c(F)cc5c4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C31H17F11O3/c1-14-12-43-29(44-13-14)15-2-3-19(21(32)7-15)16-8-24(35)27(25(36)9-16)31(41,42)45-18-6-17-10-22(33)20(4-5-30(38,39)40)28(37)26(17)23(34)11-18/h2-3,6-11,14,29H,12-13H2,1H3 |
| InChIKey | WHDNPLFDGAMZRR-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.45 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|