C29H18F8O3 — CID 138468667
2-[5,7-difluoro-6-[[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]methoxy]naphthalen-2-yl]-5-methyl-1,3-dioxane (PubChem CID 138468667) has the molecular formula C29H18F8O3 and a molecular weight of 566.44 g/mol. Its IUPAC name is 2-[5,7-difluoro-6-[[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]methoxy]naphthalen-2-yl]-5-methyl-1,3-dioxane.
| Compound Name | 2-[5,7-difluoro-6-[[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]methoxy]naphthalen-2-yl]-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 138468667 |
| Molecular Formula | C29H18F8O3 |
| Molecular Weight | 566.44 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | 2-[5,7-difluoro-6-[[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]methoxy]naphthalen-2-yl]-5-methyl-1,3-dioxane |
| SMILES | CC1COC(c2ccc3c(F)c(OCc4cc(F)c5c(F)c(C#CC(F)(F)F)c(F)cc5c4)c(F)cc3c2)OC1 |
| InChI | InChI=1S/C29H18F8O3/c1-14-11-39-28(40-12-14)16-2-3-19-17(8-16)9-23(32)27(26(19)34)38-13-15-6-18-10-21(30)20(4-5-29(35,36)37)25(33)24(18)22(31)7-15/h2-3,6-10,14,28H,11-13H2,1H3 |
| InChIKey | NBBXDHBFRGORCG-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.44 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|