C26H20F6O3 — CID 138468109
[4-(5-methyloxan-2-yl)phenoxy]-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]methanol (PubChem CID 138468109) has the molecular formula C26H20F6O3 and a molecular weight of 494.43 g/mol. Its IUPAC name is [4-(5-methyloxan-2-yl)phenoxy]-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]methanol.
| Compound Name | [4-(5-methyloxan-2-yl)phenoxy]-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 138468109 |
| Molecular Formula | C26H20F6O3 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | [4-(5-methyloxan-2-yl)phenoxy]-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]methanol |
| SMILES | CC1CCC(c2ccc(OC(O)c3cc(F)c4c(F)c(C#CC(F)(F)F)c(F)cc4c3)cc2)OC1 |
| InChI | InChI=1S/C26H20F6O3/c1-14-2-7-22(34-13-14)15-3-5-18(6-4-15)35-25(33)17-10-16-11-20(27)19(8-9-26(30,31)32)24(29)23(16)21(28)12-17/h3-6,10-12,14,22,25,33H,2,7,13H2,1H3 |
| InChIKey | IUQXOLMCANXOSR-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|