C21H10F6O2 — CID 145389448
(4-methylphenyl) 4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalene-2-carboxylate (PubChem CID 145389448) has the molecular formula C21H10F6O2 and a molecular weight of 408.30 g/mol. Its IUPAC name is (4-methylphenyl) 4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalene-2-carboxylate.
| Compound Name | (4-methylphenyl) 4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 145389448 |
| Molecular Formula | C21H10F6O2 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | (4-methylphenyl) 4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalene-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2cc(F)c3c(F)c(C#CC(F)(F)F)c(F)cc3c2)cc1 |
| InChI | InChI=1S/C21H10F6O2/c1-11-2-4-14(5-3-11)29-20(28)13-8-12-9-16(22)15(6-7-21(25,26)27)19(24)18(12)17(23)10-13/h2-5,8-10H,1H3 |
| InChIKey | VFYYEJHDHUZUQL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|