C36H19F9 — CID 138468132
1,3,8-trifluoro-6-(6-methylnaphthalen-2-yl)-2-[2-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]ethyl]naphthalene (PubChem CID 138468132) has the molecular formula C36H19F9 and a molecular weight of 622.53 g/mol. Its IUPAC name is 1,3,8-trifluoro-6-(6-methylnaphthalen-2-yl)-2-[2-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]ethyl]naphthalene.
| Compound Name | 1,3,8-trifluoro-6-(6-methylnaphthalen-2-yl)-2-[2-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]ethyl]naphthalene |
|---|---|
| PubChem CID | 138468132 |
| Molecular Formula | C36H19F9 |
| Molecular Weight | 622.53 g/mol |
| Exact Mass | 622.13 |
| IUPAC Name | 1,3,8-trifluoro-6-(6-methylnaphthalen-2-yl)-2-[2-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]ethyl]naphthalene |
| SMILES | Cc1ccc2cc(-c3cc(F)c4c(F)c(CCc5cc(F)c6c(F)c(C#CC(F)(F)F)c(F)cc6c5)c(F)cc4c3)ccc2c1 |
| InChI | InChI=1S/C36H19F9/c1-18-2-4-21-13-22(6-5-20(21)10-18)23-14-25-17-28(37)26(34(41)33(25)31(40)15-23)7-3-19-11-24-16-29(38)27(8-9-36(43,44)45)35(42)32(24)30(39)12-19/h2,4-6,10-17H,3,7H2,1H3 |
| InChIKey | TYKIAXVXPITDIZ-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.53 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|