C32H16F8 — CID 138459021
6-[1,3-difluoro-6-(4-prop-2-enylphenyl)naphthalen-2-yl]-1,3,8-trifluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene (PubChem CID 138459021) has the molecular formula C32H16F8 and a molecular weight of 552.46 g/mol. Its IUPAC name is 6-[1,3-difluoro-6-(4-prop-2-enylphenyl)naphthalen-2-yl]-1,3,8-trifluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene.
| Compound Name | 6-[1,3-difluoro-6-(4-prop-2-enylphenyl)naphthalen-2-yl]-1,3,8-trifluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
|---|---|
| PubChem CID | 138459021 |
| Molecular Formula | C32H16F8 |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 6-[1,3-difluoro-6-(4-prop-2-enylphenyl)naphthalen-2-yl]-1,3,8-trifluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
| SMILES | C=CCc1ccc(-c2ccc3c(F)c(-c4cc(F)c5c(F)c(C#CC(F)(F)F)c(F)cc5c4)c(F)cc3c2)cc1 |
| InChI | InChI=1S/C32H16F8/c1-2-3-17-4-6-18(7-5-17)19-8-9-23-20(12-19)14-26(34)28(30(23)36)22-13-21-15-25(33)24(10-11-32(38,39)40)31(37)29(21)27(35)16-22/h2,4-9,12-16H,1,3H2 |
| InChIKey | CTFXLVIOXCNJPX-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|