C25H17F5 — CID 138458482
6-[4-(cyclohexen-1-yl)phenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene (PubChem CID 138458482) has the molecular formula C25H17F5 and a molecular weight of 412.40 g/mol. Its IUPAC name is 6-[4-(cyclohexen-1-yl)phenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene.
| Compound Name | 6-[4-(cyclohexen-1-yl)phenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
|---|---|
| PubChem CID | 138458482 |
| Molecular Formula | C25H17F5 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 6-[4-(cyclohexen-1-yl)phenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
| SMILES | Fc1cc2cc(-c3ccc(C4=CCCCC4)cc3)ccc2c(F)c1C#CC(F)(F)F |
| InChI | InChI=1S/C25H17F5/c26-23-15-20-14-19(10-11-21(20)24(27)22(23)12-13-25(28,29)30)18-8-6-17(7-9-18)16-4-2-1-3-5-16/h4,6-11,14-15H,1-3,5H2 |
| InChIKey | VKFOATKRZDPTEP-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|